C18H27N3O3Si — CID 131801123
(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-trimethylsilylbutanoic acid (PubChem CID 131801123) has the molecular formula C18H27N3O3Si and a molecular weight of 361.52 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-trimethylsilylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-trimethylsilylbutanoic acid |
|---|---|
| PubChem CID | 131801123 |
| Molecular Formula | C18H27N3O3Si |
| Molecular Weight | 361.52 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-trimethylsilylbutanoic acid |
| SMILES | C[Si](C)(C)CC[C@H](NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C18H27N3O3Si/c1-25(2,3)9-8-16(18(23)24)21-17(22)14(19)10-12-11-20-15-7-5-4-6-13(12)15/h4-7,11,14,16,20H,8-10,19H2,1-3H3,(H,21,22)(H,23,24)/t14-,16-/m0/s1 |
| InChIKey | VCMLZOZESATWTI-HOCLYGCPSA-N |
| XLogP | 2.34 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|