C26H37NO3 — CID 131801338
(3S,3'R,6'S,6aS,6bS,7'aR,9S,11aS,11bS)-3-hydroxy-3',6',11b-trimethylspiro[1,2,3,4,4a,6a,6b,7,8,11a-decahydrobenzo[a]fluorene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-11-one (PubChem CID 131801338) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is (3S,3'R,6'S,6aS,6bS,7'aR,9S,11aS,11bS)-3-hydroxy-3',6',11b-trimethylspiro[1,2,3,4,4a,6a,6b,7,8,11a-decahydrobenzo[a]fluorene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-11-one.
| Compound Name | (3S,3'R,6'S,6aS,6bS,7'aR,9S,11aS,11bS)-3-hydroxy-3',6',11b-trimethylspiro[1,2,3,4,4a,6a,6b,7,8,11a-decahydrobenzo[a]fluorene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-11-one |
|---|---|
| PubChem CID | 131801338 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | (3S,3'R,6'S,6aS,6bS,7'aR,9S,11aS,11bS)-3-hydroxy-3',6',11b-trimethylspiro[1,2,3,4,4a,6a,6b,7,8,11a-decahydrobenzo[a]fluorene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-11-one |
| SMILES | C[C@@H]1CNC2[C@@H](C)[C@]3(C=C4C(=O)[C@H]5[C@@H](C=CC6C[C@@H](O)CC[C@@]65C)[C@@H]4CC3)O[C@@H]2C1 |
| InChI | InChI=1S/C26H37NO3/c1-14-10-21-23(27-13-14)15(2)26(30-21)9-7-18-19-5-4-16-11-17(28)6-8-25(16,3)22(19)24(29)20(18)12-26/h4-5,12,14-19,21-23,27-28H,6-11,13H2,1-3H3/t14-,15+,16?,17-,18-,19-,21+,22+,23?,25-,26-/m0/s1 |
| InChIKey | OVOFSCKECHRRQK-JMQPGSHFSA-N |
| XLogP | 3.65 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|