C44H76NO10P — CID 131820948
[(2R)-3-[hydroxy-[2-(methylamino)ethoxy]phosphoryl]oxy-2-[9-(3-methyl-5-pentylfuran-2-yl)nonanoyloxy]propyl] 9-(3-methyl-5-pentylfuran-2-yl)nonanoate (PubChem CID 131820948) has the molecular formula C44H76NO10P and a molecular weight of 810.06 g/mol. Its IUPAC name is [(2R)-3-[hydroxy-[2-(methylamino)ethoxy]phosphoryl]oxy-2-[9-(3-methyl-5-pentylfuran-2-yl)nonanoyloxy]propyl] 9-(3-methyl-5-pentylfuran-2-yl)nonanoate.
| Compound Name | [(2R)-3-[hydroxy-[2-(methylamino)ethoxy]phosphoryl]oxy-2-[9-(3-methyl-5-pentylfuran-2-yl)nonanoyloxy]propyl] 9-(3-methyl-5-pentylfuran-2-yl)nonanoate |
|---|---|
| PubChem CID | 131820948 |
| Molecular Formula | C44H76NO10P |
| Molecular Weight | 810.06 g/mol |
| Exact Mass | 809.52 |
| IUPAC Name | [(2R)-3-[hydroxy-[2-(methylamino)ethoxy]phosphoryl]oxy-2-[9-(3-methyl-5-pentylfuran-2-yl)nonanoyloxy]propyl] 9-(3-methyl-5-pentylfuran-2-yl)nonanoate |
| SMILES | CCCCCc1cc(C)c(CCCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCNC)OC(=O)CCCCCCCCc2oc(CCCCC)cc2C)o1 |
| InChI | InChI=1S/C44H76NO10P/c1-6-8-18-24-38-32-36(3)41(53-38)26-20-14-10-12-16-22-28-43(46)50-34-40(35-52-56(48,49)51-31-30-45-5)55-44(47)29-23-17-13-11-15-21-27-42-37(4)33-39(54-42)25-19-9-7-2/h32-33,40,45H,6-31,34-35H2,1-5H3,(H,48,49)/t40-/m1/s1 |
| InChIKey | UFYJUKQDSAGIRZ-RRHRGVEJSA-N |
| XLogP | 11.01 |
| TPSA | 146.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.06 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|