C49H87NO10P+ — CID 131770079
2-[[3-[11-(3,4-dimethyl-5-pentylfuran-2-yl)undecanoyloxy]-2-[9-(3-methyl-5-pentylfuran-2-yl)nonanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 131770079) has the molecular formula C49H87NO10P+ and a molecular weight of 881.21 g/mol. Its IUPAC name is 2-[[3-[11-(3,4-dimethyl-5-pentylfuran-2-yl)undecanoyloxy]-2-[9-(3-methyl-5-pentylfuran-2-yl)nonanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[3-[11-(3,4-dimethyl-5-pentylfuran-2-yl)undecanoyloxy]-2-[9-(3-methyl-5-pentylfuran-2-yl)nonanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 131770079 |
| Molecular Formula | C49H87NO10P+ |
| Molecular Weight | 881.21 g/mol |
| Exact Mass | 880.61 |
| IUPAC Name | 2-[[3-[11-(3,4-dimethyl-5-pentylfuran-2-yl)undecanoyloxy]-2-[9-(3-methyl-5-pentylfuran-2-yl)nonanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCc1cc(C)c(CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCc2oc(CCCCC)c(C)c2C)COP(=O)(O)OCC[N+](C)(C)C)o1 |
| InChI | InChI=1S/C49H86NO10P/c1-9-11-23-29-43-37-40(3)45(58-43)30-25-19-17-18-22-28-34-49(52)59-44(39-57-61(53,54)56-36-35-50(6,7)8)38-55-48(51)33-27-21-16-14-13-15-20-26-32-47-42(5)41(4)46(60-47)31-24-12-10-2/h37,44H,9-36,38-39H2,1-8H3/p+1 |
| InChIKey | NSEAOSBPJALRCD-UHFFFAOYSA-O |
| XLogP | 12.58 |
| TPSA | 134.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.21 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|