C43H72NO12P — CID 134159884
2-amino-3-[[3-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]-2-[9-(3-methyl-5-pentylfuran-2-yl)nonanoyloxy]propoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 134159884) has the molecular formula C43H72NO12P and a molecular weight of 826.02 g/mol. Its IUPAC name is 2-amino-3-[[3-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]-2-[9-(3-methyl-5-pentylfuran-2-yl)nonanoyloxy]propoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[[3-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]-2-[9-(3-methyl-5-pentylfuran-2-yl)nonanoyloxy]propoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134159884 |
| Molecular Formula | C43H72NO12P |
| Molecular Weight | 826.02 g/mol |
| Exact Mass | 825.48 |
| IUPAC Name | 2-amino-3-[[3-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]-2-[9-(3-methyl-5-pentylfuran-2-yl)nonanoyloxy]propoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CCCCCc1cc(C)c(CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCc2oc(CCC)c(C)c2C)COP(=O)(O)OCC(N)C(=O)O)o1 |
| InChI | InChI=1S/C43H72NO12P/c1-6-8-17-23-35-28-32(3)38(54-35)24-18-13-9-12-16-21-27-42(46)55-36(30-52-57(49,50)53-31-37(44)43(47)48)29-51-41(45)26-20-15-11-10-14-19-25-40-34(5)33(4)39(56-40)22-7-2/h28,36-37H,6-27,29-31,44H2,1-5H3,(H,47,48)(H,49,50) |
| InChIKey | SHHZDPHXRABKOA-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 197.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.02 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|