C9H8O8S — CID 131831953
3-(4-hydroxy-3-sulfooxyphenyl)-2-oxopropanoic acid (PubChem CID 131831953) has the molecular formula C9H8O8S and a molecular weight of 276.22 g/mol. Its IUPAC name is 3-(4-hydroxy-3-sulfooxyphenyl)-2-oxopropanoic acid.
| Compound Name | 3-(4-hydroxy-3-sulfooxyphenyl)-2-oxopropanoic acid |
|---|---|
| PubChem CID | 131831953 |
| Molecular Formula | C9H8O8S |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 3-(4-hydroxy-3-sulfooxyphenyl)-2-oxopropanoic acid |
| SMILES | O=C(O)C(=O)Cc1ccc(O)c(OS(=O)(=O)O)c1 |
| InChI | InChI=1S/C9H8O8S/c10-6-2-1-5(3-7(11)9(12)13)4-8(6)17-18(14,15)16/h1-2,4,10H,3H2,(H,12,13)(H,14,15,16) |
| InChIKey | OYGZUDCFIYVFLR-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|