C33H32O9 — CID 131832600
2-[2,6-dihydroxy-4-[6-hydroxy-7-(3-methylbut-2-enyl)-1-benzofuran-2-yl]phenyl]-4-methyl-6-(2,4,5-trihydroxyphenyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 131832600) has the molecular formula C33H32O9 and a molecular weight of 572.61 g/mol. Its IUPAC name is 2-[2,6-dihydroxy-4-[6-hydroxy-7-(3-methylbut-2-enyl)-1-benzofuran-2-yl]phenyl]-4-methyl-6-(2,4,5-trihydroxyphenyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 2-[2,6-dihydroxy-4-[6-hydroxy-7-(3-methylbut-2-enyl)-1-benzofuran-2-yl]phenyl]-4-methyl-6-(2,4,5-trihydroxyphenyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 131832600 |
| Molecular Formula | C33H32O9 |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | 2-[2,6-dihydroxy-4-[6-hydroxy-7-(3-methylbut-2-enyl)-1-benzofuran-2-yl]phenyl]-4-methyl-6-(2,4,5-trihydroxyphenyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC(C)=CCc1c(O)ccc2cc(-c3cc(O)c(C4C=C(C)CC(c5cc(O)c(O)cc5O)C4C(=O)O)c(O)c3)oc12 |
| InChI | InChI=1S/C33H32O9/c1-15(2)4-6-19-23(34)7-5-17-12-29(42-32(17)19)18-10-27(38)31(28(39)11-18)22-9-16(3)8-21(30(22)33(40)41)20-13-25(36)26(37)14-24(20)35/h4-5,7,9-14,21-22,30,34-39H,6,8H2,1-3H3,(H,40,41) |
| InChIKey | APOAUMSKFSHYGA-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 171.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|