About (1-cyano-2-methylprop-2-enyl) (Z)-octadec-11-enoate
(1-cyano-2-methylprop-2-enyl) (Z)-octadec-11-enoate (PubChem CID 131841352) has the molecular formula C23H39NO2
and a molecular weight of 361.57 g/mol. Its IUPAC name is (1-cyano-2-methylprop-2-enyl) (Z)-octadec-11-enoate.
Molecular Properties
| Compound Name | (1-cyano-2-methylprop-2-enyl) (Z)-octadec-11-enoate |
| PubChem CID | 131841352 |
| Molecular Formula | C23H39NO2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | (1-cyano-2-methylprop-2-enyl) (Z)-octadec-11-enoate |
| SMILES | C=C(C)C(C#N)OC(=O)CCCCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C23H39NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(25)26-22(20-24)21(2)3/h9-10,22H,2,4-8,11-19H2,1,3H3/b10-9- |
| InChIKey | HGVOWTYDWNIBEC-KTKRTIGZSA-N |
| XLogP | 7.04 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1-cyano-2-methylprop-2-enyl) (Z)-octadec-11-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyano-2-methylprop-2-enyl) (Z)-octadec-11-enoate?
The IUPAC name of (1-cyano-2-methylprop-2-enyl) (Z)-octadec-11-enoate (CID 131841352) is (1-cyano-2-methylprop-2-enyl) (Z)-octadec-11-enoate.
What is the SMILES notation for (1-cyano-2-methylprop-2-enyl) (Z)-octadec-11-enoate?
The canonical SMILES for (1-cyano-2-methylprop-2-enyl) (Z)-octadec-11-enoate is C=C(C)C(C#N)OC(=O)CCCCCCCCC/C=C\CCCCCC.
What is the InChIKey of (1-cyano-2-methylprop-2-enyl) (Z)-octadec-11-enoate?
The InChIKey is HGVOWTYDWNIBEC-KTKRTIGZSA-N. The full InChI is InChI=1S/C23H39NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(25)26-22(20-24)21(2)3/h9-10,22H,2,4-8,11-19H2,1,3H3/b10-9-.
What are the key properties of (1-cyano-2-methylprop-2-enyl) (Z)-octadec-11-enoate?
(1-cyano-2-methylprop-2-enyl) (Z)-octadec-11-enoate has a molecular weight of 361.57 g/mol, XLogP of 7.04, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyano-2-methylprop-2-enyl) (Z)-octadec-11-enoate is sourced from PubChem (CID 131841352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).