C25H41NO2 — CID 131841357
(1-cyano-2-methylprop-2-enyl) (11Z,14Z)-icosa-11,14-dienoate (PubChem CID 131841357) has the molecular formula C25H41NO2 and a molecular weight of 387.61 g/mol. Its IUPAC name is (1-cyano-2-methylprop-2-enyl) (11Z,14Z)-icosa-11,14-dienoate.
| Compound Name | (1-cyano-2-methylprop-2-enyl) (11Z,14Z)-icosa-11,14-dienoate |
|---|---|
| PubChem CID | 131841357 |
| Molecular Formula | C25H41NO2 |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.31 |
| IUPAC Name | (1-cyano-2-methylprop-2-enyl) (11Z,14Z)-icosa-11,14-dienoate |
| SMILES | C=C(C)C(C#N)OC(=O)CCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C25H41NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(27)28-24(22-26)23(2)3/h8-9,11-12,24H,2,4-7,10,13-21H2,1,3H3/b9-8-,12-11- |
| InChIKey | AJPBIUFGQARABL-MURFETPASA-N |
| XLogP | 7.59 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|