C10H15N2O4- — CID 131841435
3-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]butanoate (PubChem CID 131841435) has the molecular formula C10H15N2O4- and a molecular weight of 227.24 g/mol. Its IUPAC name is 3-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]butanoate.
| Compound Name | 3-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 131841435 |
| Molecular Formula | C10H15N2O4- |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 3-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]butanoate |
| SMILES | CC(C)C(NC(=O)[C@@H]1CCC(=O)N1)C(=O)[O-] |
| InChI | InChI=1S/C10H16N2O4/c1-5(2)8(10(15)16)12-9(14)6-3-4-7(13)11-6/h5-6,8H,3-4H2,1-2H3,(H,11,13)(H,12,14)(H,15,16)/p-1/t6-,8?/m0/s1 |
| InChIKey | DTSWLLBBGHRXQH-UUEFVBAFSA-M |
| XLogP | -1.84 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |