C14H24N2O4 — CID 103762213
tert-butyl (2S)-3-methyl-2-[[(2R)-5-oxopyrrolidine-2-carbonyl]amino]butanoate (PubChem CID 103762213) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is tert-butyl (2S)-3-methyl-2-[[(2R)-5-oxopyrrolidine-2-carbonyl]amino]butanoate.
| Compound Name | tert-butyl (2S)-3-methyl-2-[[(2R)-5-oxopyrrolidine-2-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 103762213 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | tert-butyl (2S)-3-methyl-2-[[(2R)-5-oxopyrrolidine-2-carbonyl]amino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)[C@H]1CCC(=O)N1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24N2O4/c1-8(2)11(13(19)20-14(3,4)5)16-12(18)9-6-7-10(17)15-9/h8-9,11H,6-7H2,1-5H3,(H,15,17)(H,16,18)/t9-,11+/m1/s1 |
| InChIKey | OHMXCGWTXHVRPN-KOLCDFICSA-N |
| XLogP | 0.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |