C15H28N2O3 — CID 11778633
tert-butyl (2S)-3-methyl-2-[[(2S)-piperidine-2-carbonyl]amino]butanoate (PubChem CID 11778633) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is tert-butyl (2S)-3-methyl-2-[[(2S)-piperidine-2-carbonyl]amino]butanoate.
| Compound Name | tert-butyl (2S)-3-methyl-2-[[(2S)-piperidine-2-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 11778633 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | tert-butyl (2S)-3-methyl-2-[[(2S)-piperidine-2-carbonyl]amino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)[C@@H]1CCCCN1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28N2O3/c1-10(2)12(14(19)20-15(3,4)5)17-13(18)11-8-6-7-9-16-11/h10-12,16H,6-9H2,1-5H3,(H,17,18)/t11-,12-/m0/s1 |
| InChIKey | PUFIWXMLOFWSBU-RYUDHWBXSA-N |
| XLogP | 1.61 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |