C20H19FN2O3S — CID 131841676
(2Z)-2-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]-N-(2-methoxyethyl)acetamide (PubChem CID 131841676) has the molecular formula C20H19FN2O3S and a molecular weight of 386.45 g/mol. Its IUPAC name is (2Z)-2-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]-N-(2-methoxyethyl)acetamide.
| Compound Name | (2Z)-2-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 131841676 |
| Molecular Formula | C20H19FN2O3S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | (2Z)-2-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)/C=C1\Sc2ccccc2N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C20H19FN2O3S/c1-26-11-10-22-19(24)12-18-20(25)23(13-14-6-8-15(21)9-7-14)16-4-2-3-5-17(16)27-18/h2-9,12H,10-11,13H2,1H3,(H,22,24)/b18-12- |
| InChIKey | SLORYIIRNBXHLL-PDGQHHTCSA-N |
| XLogP | 3.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|