C20H33NOS — CID 131842325
(1S,2R)-1-(3,4-dihydro-2H-thiochromen-6-yl)-2-(octylamino)propan-1-ol (PubChem CID 131842325) has the molecular formula C20H33NOS and a molecular weight of 335.56 g/mol. Its IUPAC name is (1S,2R)-1-(3,4-dihydro-2H-thiochromen-6-yl)-2-(octylamino)propan-1-ol.
| Compound Name | (1S,2R)-1-(3,4-dihydro-2H-thiochromen-6-yl)-2-(octylamino)propan-1-ol |
|---|---|
| PubChem CID | 131842325 |
| Molecular Formula | C20H33NOS |
| Molecular Weight | 335.56 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | (1S,2R)-1-(3,4-dihydro-2H-thiochromen-6-yl)-2-(octylamino)propan-1-ol |
| SMILES | CCCCCCCCN[C@H](C)[C@@H](O)c1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C20H33NOS/c1-3-4-5-6-7-8-13-21-16(2)20(22)18-11-12-19-17(15-18)10-9-14-23-19/h11-12,15-16,20-22H,3-10,13-14H2,1-2H3/t16-,20-/m1/s1 |
| InChIKey | NGLJZOICHPACDB-OXQOHEQNSA-N |
| XLogP | 5.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|