C9H13Cl — CID 131843170
(1R,7S,8R)-8-chloro-8-methylbicyclo[5.1.0]oct-2-ene (PubChem CID 131843170) has the molecular formula C9H13Cl and a molecular weight of 156.66 g/mol. Its IUPAC name is (1R,7S,8R)-8-chloro-8-methylbicyclo[5.1.0]oct-2-ene.
| Compound Name | (1R,7S,8R)-8-chloro-8-methylbicyclo[5.1.0]oct-2-ene |
|---|---|
| PubChem CID | 131843170 |
| Molecular Formula | C9H13Cl |
| Molecular Weight | 156.66 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | (1R,7S,8R)-8-chloro-8-methylbicyclo[5.1.0]oct-2-ene |
| SMILES | C[C@]1(Cl)[C@@H]2C=CCCC[C@@H]21 |
| InChI | InChI=1S/C9H13Cl/c1-9(10)7-5-3-2-4-6-8(7)9/h3,5,7-8H,2,4,6H2,1H3/t7-,8+,9+/m1/s1 |
| InChIKey | PCARUSHROSPXGZ-VGMNWLOBSA-N |
| XLogP | 2.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.66 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|