C12H21NO — CID 131845796
5-(1-amino-1,2,2,2-tetradeuterioethyl)adamantan-2-ol (PubChem CID 131845796) has the molecular formula C12H21NO and a molecular weight of 199.33 g/mol. Its IUPAC name is 5-(1-amino-1,2,2,2-tetradeuterioethyl)adamantan-2-ol.
| Compound Name | 5-(1-amino-1,2,2,2-tetradeuterioethyl)adamantan-2-ol |
|---|---|
| PubChem CID | 131845796 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 199.33 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 5-(1-amino-1,2,2,2-tetradeuterioethyl)adamantan-2-ol |
| SMILES | [2H]C([2H])([2H])C([2H])(N)C12CC3CC(C1)C(O)C(C3)C2 |
| InChI | InChI=1S/C12H21NO/c1-7(13)12-4-8-2-9(5-12)11(14)10(3-8)6-12/h7-11,14H,2-6,13H2,1H3/i1D3,7D |
| InChIKey | IKZHOAXNYUBUDD-CWIRFKENSA-N |
| XLogP | 1.52 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |