C13H17Cl — CID 131847427
1-chloro-4-[(3S,4R)-4-methylhex-1-en-3-yl]benzene (PubChem CID 131847427) has the molecular formula C13H17Cl and a molecular weight of 208.73 g/mol. Its IUPAC name is 1-chloro-4-[(3S,4R)-4-methylhex-1-en-3-yl]benzene.
| Compound Name | 1-chloro-4-[(3S,4R)-4-methylhex-1-en-3-yl]benzene |
|---|---|
| PubChem CID | 131847427 |
| Molecular Formula | C13H17Cl |
| Molecular Weight | 208.73 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-chloro-4-[(3S,4R)-4-methylhex-1-en-3-yl]benzene |
| SMILES | C=C[C@H](c1ccc(Cl)cc1)[C@H](C)CC |
| InChI | InChI=1S/C13H17Cl/c1-4-10(3)13(5-2)11-6-8-12(14)9-7-11/h5-10,13H,2,4H2,1,3H3/t10-,13+/m1/s1 |
| InChIKey | NDJRLWJDYQOORU-MFKMUULPSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.73 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|