C54H50I2N2O2 — CID 13185037
4-(4-methoxyphenyl)-1-[6-[4-(4-methoxyphenyl)-2,6-diphenylpyridin-1-ium-1-yl]hexyl]-2,6-diphenylpyridin-1-ium diiodide (PubChem CID 13185037) has the molecular formula C54H50I2N2O2 and a molecular weight of 1012.81 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1-[6-[4-(4-methoxyphenyl)-2,6-diphenylpyridin-1-ium-1-yl]hexyl]-2,6-diphenylpyridin-1-ium diiodide.
| Compound Name | 4-(4-methoxyphenyl)-1-[6-[4-(4-methoxyphenyl)-2,6-diphenylpyridin-1-ium-1-yl]hexyl]-2,6-diphenylpyridin-1-ium diiodide |
|---|---|
| PubChem CID | 13185037 |
| Molecular Formula | C54H50I2N2O2 |
| Molecular Weight | 1012.81 g/mol |
| Exact Mass | 1012.20 |
| IUPAC Name | 4-(4-methoxyphenyl)-1-[6-[4-(4-methoxyphenyl)-2,6-diphenylpyridin-1-ium-1-yl]hexyl]-2,6-diphenylpyridin-1-ium diiodide |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)[n+](CCCCCC[n+]3c(-c4ccccc4)cc(-c4ccc(OC)cc4)cc3-c3ccccc3)c(-c3ccccc3)c2)cc1.[I-].[I-] |
| InChI | InChI=1S/C54H50N2O2.2HI/c1-57-49-31-27-41(28-32-49)47-37-51(43-19-9-5-10-20-43)55(52(38-47)44-21-11-6-12-22-44)35-17-3-4-18-36-56-53(45-23-13-7-14-24-45)39-48(42-29-33-50(58-2)34-30-42)40-54(56)46-25-15-8-16-26-46;;/h5-16,19-34,37-40H,3-4,17-18,35-36H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | SMNZGKFLWOEKIY-UHFFFAOYSA-L |
| XLogP | 6.55 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1012.81 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|