C28H37ClN2O6 — CID 16682556
2-[2,4-bis(4-ethoxyphenyl)-6-methylpyridin-1-ium-1-yl]-N,N-diethylethanamine perchlorate (PubChem CID 16682556) has the molecular formula C28H37ClN2O6 and a molecular weight of 533.07 g/mol. Its IUPAC name is 2-[2,4-bis(4-ethoxyphenyl)-6-methylpyridin-1-ium-1-yl]-N,N-diethylethanamine perchlorate.
| Compound Name | 2-[2,4-bis(4-ethoxyphenyl)-6-methylpyridin-1-ium-1-yl]-N,N-diethylethanamine perchlorate |
|---|---|
| PubChem CID | 16682556 |
| Molecular Formula | C28H37ClN2O6 |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 2-[2,4-bis(4-ethoxyphenyl)-6-methylpyridin-1-ium-1-yl]-N,N-diethylethanamine perchlorate |
| SMILES | CCOc1ccc(-c2cc(C)[n+](CCN(CC)CC)c(-c3ccc(OCC)cc3)c2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C28H37N2O2.ClHO4/c1-6-29(7-2)18-19-30-22(5)20-25(23-10-14-26(15-11-23)31-8-3)21-28(30)24-12-16-27(17-13-24)32-9-4;2-1(3,4)5/h10-17,20-21H,6-9,18-19H2,1-5H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | BFUSLBQAPFZGJE-UHFFFAOYSA-M |
| XLogP | 1.00 |
| TPSA | 117.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|