C10H16N2O — CID 131851229
(2S)-4-phenoxybutane-1,2-diamine (PubChem CID 131851229) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (2S)-4-phenoxybutane-1,2-diamine.
| Compound Name | (2S)-4-phenoxybutane-1,2-diamine |
|---|---|
| PubChem CID | 131851229 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (2S)-4-phenoxybutane-1,2-diamine |
| SMILES | NC[C@@H](N)CCOc1ccccc1 |
| InChI | InChI=1S/C10H16N2O/c11-8-9(12)6-7-13-10-4-2-1-3-5-10/h1-5,9H,6-8,11-12H2/t9-/m0/s1 |
| InChIKey | UASCEWLVWFKCAO-VIFPVBQESA-N |
| XLogP | 0.74 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |