C11H19KNO10S2 — CID 131851252
CID 131851252 (PubChem CID 131851252) has the molecular formula C11H19KNO10S2 and a molecular weight of 428.50 g/mol.
| Compound Name | CID 131851252 |
|---|---|
| PubChem CID | 131851252 |
| Molecular Formula | C11H19KNO10S2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | — |
| SMILES | C=C[C@@H](O)CC(=NOS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O.[K] |
| InChI | InChI=1S/C11H19NO10S2.K/c1-2-5(14)3-7(12-22-24(18,19)20)23-11-10(17)9(16)8(15)6(4-13)21-11;/h2,5-6,8-11,13-17H,1,3-4H2,(H,18,19,20);/t5-,6-,8-,9+,10-,11+;/m1./s1 |
| InChIKey | FWOFGVFUDQYSRF-ZQVFBYEASA-N |
| XLogP | -2.79 |
| TPSA | 186.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|