C12H21NO9S2 — CID 172981294
[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1E,3S)-3-hydroxy-N-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxypent-4-enimidothioate (PubChem CID 172981294) has the molecular formula C12H21NO9S2 and a molecular weight of 387.43 g/mol. Its IUPAC name is [(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1E,3S)-3-hydroxy-N-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxypent-4-enimidothioate.
| Compound Name | [(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1E,3S)-3-hydroxy-N-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxypent-4-enimidothioate |
|---|---|
| PubChem CID | 172981294 |
| Molecular Formula | C12H21NO9S2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | [(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1E,3S)-3-hydroxy-N-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxypent-4-enimidothioate |
| SMILES | C=C[C@@H](O)C/C(=N\OS(=C)(=O)O)S[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C12H21NO9S2/c1-3-6(15)4-8(13-22-24(2,19)20)23-12-11(18)10(17)9(16)7(5-14)21-12/h3,6-7,9-12,14-18H,1-2,4-5H2,(H,19,20)/b13-8+/t6-,7?,9-,10+,11?,12+/m1/s1 |
| InChIKey | NCBIZRRZPMXKCG-BSSZPNDYSA-N |
| XLogP | -2.11 |
| TPSA | 169.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|