C10H17NO8S2 — CID 163178789
1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylbut-3-enylidenesulfamic acid (PubChem CID 163178789) has the molecular formula C10H17NO8S2 and a molecular weight of 343.38 g/mol. Its IUPAC name is 1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylbut-3-enylidenesulfamic acid.
| Compound Name | 1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylbut-3-enylidenesulfamic acid |
|---|---|
| PubChem CID | 163178789 |
| Molecular Formula | C10H17NO8S2 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylbut-3-enylidenesulfamic acid |
| SMILES | C=CCC(=NS(=O)(=O)O)SC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C10H17NO8S2/c1-2-3-6(11-21(16,17)18)20-10-9(15)8(14)7(13)5(4-12)19-10/h2,5,7-10,12-15H,1,3-4H2,(H,16,17,18) |
| InChIKey | YHOBVOQYONIVDM-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 156.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|