C15H20NO10S2- — CID 101243556
4-[(1S)-1-hydroxy-3-sulfoimino-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropyl]phenolate (PubChem CID 101243556) has the molecular formula C15H20NO10S2- and a molecular weight of 438.46 g/mol. Its IUPAC name is 4-[(1S)-1-hydroxy-3-sulfoimino-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropyl]phenolate.
| Compound Name | 4-[(1S)-1-hydroxy-3-sulfoimino-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropyl]phenolate |
|---|---|
| PubChem CID | 101243556 |
| Molecular Formula | C15H20NO10S2- |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 4-[(1S)-1-hydroxy-3-sulfoimino-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropyl]phenolate |
| SMILES | O=S(=O)(O)N=C(C[C@H](O)c1ccc([O-])cc1)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H21NO10S2/c17-6-10-12(20)13(21)14(22)15(26-10)27-11(16-28(23,24)25)5-9(19)7-1-3-8(18)4-2-7/h1-4,9-10,12-15,17-22H,5-6H2,(H,23,24,25)/p-1/t9-,10+,12+,13-,14+,15-/m0/s1 |
| InChIKey | DHWRHZCOKHQCEP-YQBXUVTMSA-M |
| XLogP | -2.08 |
| TPSA | 200.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|