C9H13ClO — CID 131853161
trans-(1R,2S)-2-ethenyl-1-methylcyclopentane-1-carbonyl chloride (PubChem CID 131853161) has the molecular formula C9H13ClO and a molecular weight of 172.66 g/mol. Its IUPAC name is trans-(1R,2S)-2-ethenyl-1-methylcyclopentane-1-carbonyl chloride.
| Compound Name | trans-(1R,2S)-2-ethenyl-1-methylcyclopentane-1-carbonyl chloride |
|---|---|
| PubChem CID | 131853161 |
| Molecular Formula | C9H13ClO |
| Molecular Weight | 172.66 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | trans-(1R,2S)-2-ethenyl-1-methylcyclopentane-1-carbonyl chloride |
| SMILES | C=C[C@@H]1CCC[C@@]1(C)C(=O)Cl |
| InChI | InChI=1S/C9H13ClO/c1-3-7-5-4-6-9(7,2)8(10)11/h3,7H,1,4-6H2,2H3/t7-,9-/m1/s1 |
| InChIKey | OZIAVPIRLFAYIK-VXNVDRBHSA-N |
| XLogP | 2.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.66 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|