C10H16O — CID 102275589
(1S,5R,7S)-7-ethenyl-1-methyl-8-oxabicyclo[3.2.1]octane (PubChem CID 102275589) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (1S,5R,7S)-7-ethenyl-1-methyl-8-oxabicyclo[3.2.1]octane.
| Compound Name | (1S,5R,7S)-7-ethenyl-1-methyl-8-oxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 102275589 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (1S,5R,7S)-7-ethenyl-1-methyl-8-oxabicyclo[3.2.1]octane |
| SMILES | C=C[C@@H]1C[C@H]2CCC[C@]1(C)O2 |
| InChI | InChI=1S/C10H16O/c1-3-8-7-9-5-4-6-10(8,2)11-9/h3,8-9H,1,4-7H2,2H3/t8-,9-,10+/m1/s1 |
| InChIKey | BHSZJNQJEUVXDZ-BBBLOLIVSA-N |
| XLogP | 2.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|