C10H14O5 — CID 131853922
dimethyl 2-ethyl-2,3-dihydrofuran-4,5-dicarboxylate (PubChem CID 131853922) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is dimethyl 2-ethyl-2,3-dihydrofuran-4,5-dicarboxylate.
| Compound Name | dimethyl 2-ethyl-2,3-dihydrofuran-4,5-dicarboxylate |
|---|---|
| PubChem CID | 131853922 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | dimethyl 2-ethyl-2,3-dihydrofuran-4,5-dicarboxylate |
| SMILES | CCC1CC(C(=O)OC)=C(C(=O)OC)O1 |
| InChI | InChI=1S/C10H14O5/c1-4-6-5-7(9(11)13-2)8(15-6)10(12)14-3/h6H,4-5H2,1-3H3 |
| InChIKey | KJUIPJUODLKVTP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |