C6H8INO2 — CID 131856757
(3R,5S)-3-(iodomethyl)-4-oxa-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 131856757) has the molecular formula C6H8INO2 and a molecular weight of 253.04 g/mol. Its IUPAC name is (3R,5S)-3-(iodomethyl)-4-oxa-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (3R,5S)-3-(iodomethyl)-4-oxa-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 131856757 |
| Molecular Formula | C6H8INO2 |
| Molecular Weight | 253.04 g/mol |
| Exact Mass | 252.96 |
| IUPAC Name | (3R,5S)-3-(iodomethyl)-4-oxa-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | O=C1C[C@@H]2O[C@@H](CI)CN12 |
| InChI | InChI=1S/C6H8INO2/c7-2-4-3-8-5(9)1-6(8)10-4/h4,6H,1-3H2/t4-,6-/m0/s1 |
| InChIKey | GRTITBIPWPSDPZ-NJGYIYPDSA-N |
| XLogP | 0.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.04 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|