C6H7NNaO4 — CID 131866551
CID 131866551 (PubChem CID 131866551) has the molecular formula C6H7NNaO4 and a molecular weight of 180.11 g/mol.
| Compound Name | CID 131866551 |
|---|---|
| PubChem CID | 131866551 |
| Molecular Formula | C6H7NNaO4 |
| Molecular Weight | 180.11 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | — |
| SMILES | O=C(O)[C@H]1CN2C(=O)C[C@@H]2O1.[Na] |
| InChI | InChI=1S/C6H7NO4.Na/c8-4-1-5-7(4)2-3(11-5)6(9)10;/h3,5H,1-2H2,(H,9,10);/t3-,5+;/m1./s1 |
| InChIKey | QABVQBFAINTBAC-ZJQZTCRYSA-N |
| XLogP | -1.35 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.11 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |