C12H16O — CID 131856986
(2aS,5aS,9R)-3,5a,6,7,8,9-hexahydro-2aH-cyclobuta[i]naphthalen-9-ol (PubChem CID 131856986) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is (2aS,5aS,9R)-3,5a,6,7,8,9-hexahydro-2aH-cyclobuta[i]naphthalen-9-ol.
| Compound Name | (2aS,5aS,9R)-3,5a,6,7,8,9-hexahydro-2aH-cyclobuta[i]naphthalen-9-ol |
|---|---|
| PubChem CID | 131856986 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (2aS,5aS,9R)-3,5a,6,7,8,9-hexahydro-2aH-cyclobuta[i]naphthalen-9-ol |
| SMILES | O[C@@H]1CCC[C@H]2C=CC[C@H]3C=CC132 |
| InChI | InChI=1S/C12H16O/c13-11-6-2-5-9-3-1-4-10-7-8-12(9,10)11/h1,3,7-11,13H,2,4-6H2/t9-,10+,11-,12?/m1/s1 |
| InChIKey | ZYXDSWWSQJYPJV-FBTJUVTCSA-N |
| XLogP | 2.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|