C9H14N4O4 — CID 131857041
[(1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene)amino] N-ethylcarbamate (PubChem CID 131857041) has the molecular formula C9H14N4O4 and a molecular weight of 242.23 g/mol. Its IUPAC name is [(1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene)amino] N-ethylcarbamate.
| Compound Name | [(1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene)amino] N-ethylcarbamate |
|---|---|
| PubChem CID | 131857041 |
| Molecular Formula | C9H14N4O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | [(1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene)amino] N-ethylcarbamate |
| SMILES | CCNC(=O)ON=C1CC(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C9H14N4O4/c1-4-10-8(15)17-11-6-5-7(14)13(3)9(16)12(6)2/h4-5H2,1-3H3,(H,10,15) |
| InChIKey | FOZBBNAZDHLJQQ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|