C8H11N3O4 — CID 131855838
[(1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene)amino] acetate (PubChem CID 131855838) has the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. Its IUPAC name is [(1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene)amino] acetate.
| Compound Name | [(1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene)amino] acetate |
|---|---|
| PubChem CID | 131855838 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | [(1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene)amino] acetate |
| SMILES | CC(=O)ON=C1CC(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C8H11N3O4/c1-5(12)15-9-6-4-7(13)11(3)8(14)10(6)2/h4H2,1-3H3 |
| InChIKey | OVYFHJNSXXQZBF-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|