C6H9N3O3 — CID 6791968
6-hydroxyimino-1,3-dimethyl-1,3-diazinane-2,4-dione (PubChem CID 6791968) has the molecular formula C6H9N3O3 and a molecular weight of 171.16 g/mol. Its IUPAC name is 6-hydroxyimino-1,3-dimethyl-1,3-diazinane-2,4-dione.
| Compound Name | 6-hydroxyimino-1,3-dimethyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 6791968 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 6-hydroxyimino-1,3-dimethyl-1,3-diazinane-2,4-dione |
| SMILES | CN1C(=O)CC(=NO)N(C)C1=O |
| InChI | InChI=1S/C6H9N3O3/c1-8-4(7-12)3-5(10)9(2)6(8)11/h12H,3H2,1-2H3 |
| InChIKey | RTHHBQWWMYIBGA-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|