C6H10N4O2 — CID 21117207
(6E)-6-hydrazinylidene-1,3-dimethyl-1,3-diazinane-2,4-dione (PubChem CID 21117207) has the molecular formula C6H10N4O2 and a molecular weight of 170.17 g/mol. Its IUPAC name is (6E)-6-hydrazinylidene-1,3-dimethyl-1,3-diazinane-2,4-dione.
| Compound Name | (6E)-6-hydrazinylidene-1,3-dimethyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 21117207 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | (6E)-6-hydrazinylidene-1,3-dimethyl-1,3-diazinane-2,4-dione |
| SMILES | CN1C(=O)C/C(=N\N)N(C)C1=O |
| InChI | InChI=1S/C6H10N4O2/c1-9-4(8-7)3-5(11)10(2)6(9)12/h3,7H2,1-2H3/b8-4+ |
| InChIKey | NKLILMZCEJZRCG-XBXARRHUSA-N |
| XLogP | -0.83 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|