C8H12N5O2+ — CID 76852009
1-[(4-imino-1,3-dimethyl-2,6-dioxo-1,3-diazinan-5-ylidene)amino]ethylideneazanium (PubChem CID 76852009) has the molecular formula C8H12N5O2+ and a molecular weight of 210.22 g/mol. Its IUPAC name is 1-[(4-imino-1,3-dimethyl-2,6-dioxo-1,3-diazinan-5-ylidene)amino]ethylideneazanium.
| Compound Name | 1-[(4-imino-1,3-dimethyl-2,6-dioxo-1,3-diazinan-5-ylidene)amino]ethylideneazanium |
|---|---|
| PubChem CID | 76852009 |
| Molecular Formula | C8H12N5O2+ |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 1-[(4-imino-1,3-dimethyl-2,6-dioxo-1,3-diazinan-5-ylidene)amino]ethylideneazanium |
| SMILES | [H]/N=C1C(=N/C(C)=[NH2+])/C(=O)N(C)C(=O)N/1C |
| InChI | InChI=1S/C8H11N5O2/c1-4(9)11-5-6(10)12(2)8(15)13(3)7(5)14/h9-10H,1-3H3/p+1/b9-4?,10-6-,11-5- |
| InChIKey | CLQBAEGMAPKXCD-DKQRGPSRSA-O |
| XLogP | -1.89 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|