C6H11N4O2+ — CID 59127878
(5-amino-1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene)azanium (PubChem CID 59127878) has the molecular formula C6H11N4O2+ and a molecular weight of 171.18 g/mol. Its IUPAC name is (5-amino-1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene)azanium.
| Compound Name | (5-amino-1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene)azanium |
|---|---|
| PubChem CID | 59127878 |
| Molecular Formula | C6H11N4O2+ |
| Molecular Weight | 171.18 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (5-amino-1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene)azanium |
| SMILES | CN1C(=[NH2+])C(N)C(=O)N(C)C1=O |
| InChI | InChI=1S/C6H10N4O2/c1-9-4(8)3(7)5(11)10(2)6(9)12/h3,8H,7H2,1-2H3/p+1 |
| InChIKey | LBUNLNCSEJXOIL-UHFFFAOYSA-O |
| XLogP | -3.00 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.18 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|