C7H9N4O2+ — CID 73066030
1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 73066030) has the molecular formula C7H9N4O2+ and a molecular weight of 181.17 g/mol. Its IUPAC name is 1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73066030 |
| Molecular Formula | C7H9N4O2+ |
| Molecular Weight | 181.17 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2[NH+]=CN=C2N(C)C1=O |
| InChI | InChI=1S/C7H8N4O2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13/h3-4H,1-2H3/p+1 |
| InChIKey | YCEKCTUKFCMUPE-UHFFFAOYSA-O |
| XLogP | -2.60 |
| TPSA | 66.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.17 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |