C7H13N4O2+ — CID 71650988
(5-amino-1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene)-methylazanium (PubChem CID 71650988) has the molecular formula C7H13N4O2+ and a molecular weight of 185.21 g/mol. Its IUPAC name is (5-amino-1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene)-methylazanium.
| Compound Name | (5-amino-1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene)-methylazanium |
|---|---|
| PubChem CID | 71650988 |
| Molecular Formula | C7H13N4O2+ |
| Molecular Weight | 185.21 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | (5-amino-1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene)-methylazanium |
| SMILES | C/[NH+]=C1/C(N)C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C7H12N4O2/c1-9-5-4(8)6(12)11(3)7(13)10(5)2/h4H,8H2,1-3H3/p+1/b9-5- |
| InChIKey | LUSCDINQGCUZPR-UITAMQMPSA-O |
| XLogP | -3.05 |
| TPSA | 80.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.21 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|