C8H13N5O2 — CID 135393520
(6R)-2-amino-6-methyl-4-oxo-1,2,3,4a,6,7-hexahydropteridine-5-carbaldehyde (PubChem CID 135393520) has the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. Its IUPAC name is (6R)-2-amino-6-methyl-4-oxo-1,2,3,4a,6,7-hexahydropteridine-5-carbaldehyde.
| Compound Name | (6R)-2-amino-6-methyl-4-oxo-1,2,3,4a,6,7-hexahydropteridine-5-carbaldehyde |
|---|---|
| PubChem CID | 135393520 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | (6R)-2-amino-6-methyl-4-oxo-1,2,3,4a,6,7-hexahydropteridine-5-carbaldehyde |
| SMILES | C[C@@H]1CN=C2NC(N)NC(=O)C2N1C=O |
| InChI | InChI=1S/C8H13N5O2/c1-4-2-10-6-5(13(4)3-14)7(15)12-8(9)11-6/h3-5,8H,2,9H2,1H3,(H,10,11)(H,12,15)/t4-,5?,8?/m1/s1 |
| InChIKey | VGLPRUPKJWKIAC-YLTAPMQJSA-N |
| XLogP | -2.42 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|