C7H11N5O2 — CID 54049739
2-amino-4-oxo-2,3,4a,5,6,7-hexahydro-1H-pteridine-6-carbaldehyde (PubChem CID 54049739) has the molecular formula C7H11N5O2 and a molecular weight of 197.20 g/mol. Its IUPAC name is 2-amino-4-oxo-2,3,4a,5,6,7-hexahydro-1H-pteridine-6-carbaldehyde.
| Compound Name | 2-amino-4-oxo-2,3,4a,5,6,7-hexahydro-1H-pteridine-6-carbaldehyde |
|---|---|
| PubChem CID | 54049739 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-amino-4-oxo-2,3,4a,5,6,7-hexahydro-1H-pteridine-6-carbaldehyde |
| SMILES | NC1NC(=O)C2NC(C=O)CN=C2N1 |
| InChI | InChI=1S/C7H11N5O2/c8-7-11-5-4(6(14)12-7)10-3(2-13)1-9-5/h2-4,7,10H,1,8H2,(H,9,11)(H,12,14) |
| InChIKey | LSAXXPJBSLNBBZ-UHFFFAOYSA-N |
| XLogP | -3.11 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|