C7H11N5O — CID 54537290
2-amino-6-methyl-2,3,4a,7-tetrahydro-1H-pteridin-4-one (PubChem CID 54537290) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is 2-amino-6-methyl-2,3,4a,7-tetrahydro-1H-pteridin-4-one.
| Compound Name | 2-amino-6-methyl-2,3,4a,7-tetrahydro-1H-pteridin-4-one |
|---|---|
| PubChem CID | 54537290 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 2-amino-6-methyl-2,3,4a,7-tetrahydro-1H-pteridin-4-one |
| SMILES | CC1=NC2C(=O)NC(N)NC2=NC1 |
| InChI | InChI=1S/C7H11N5O/c1-3-2-9-5-4(10-3)6(13)12-7(8)11-5/h4,7H,2,8H2,1H3,(H,9,11)(H,12,13) |
| InChIKey | ZARJINDSBMWFPV-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 91.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |