C7H11N5O — CID 91227454
2-(methylamino)-2,3,6,7-tetrahydro-1H-pteridin-4-one (PubChem CID 91227454) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is 2-(methylamino)-2,3,6,7-tetrahydro-1H-pteridin-4-one.
| Compound Name | 2-(methylamino)-2,3,6,7-tetrahydro-1H-pteridin-4-one |
|---|---|
| PubChem CID | 91227454 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 2-(methylamino)-2,3,6,7-tetrahydro-1H-pteridin-4-one |
| SMILES | CNC1NC(=O)C2=NCCN=C2N1 |
| InChI | InChI=1S/C7H11N5O/c1-8-7-11-5-4(6(13)12-7)9-2-3-10-5/h7-8H,2-3H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | WVIQYTPRIMMFOQ-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |