C5H7N3O2 — CID 14483225
6-imino-1-methyl-1,3-diazinane-2,4-dione (PubChem CID 14483225) has the molecular formula C5H7N3O2 and a molecular weight of 141.13 g/mol. Its IUPAC name is 6-imino-1-methyl-1,3-diazinane-2,4-dione.
| Compound Name | 6-imino-1-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 14483225 |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | 6-imino-1-methyl-1,3-diazinane-2,4-dione |
| SMILES | [H]/N=C1\CC(=O)NC(=O)N1C |
| InChI | InChI=1S/C5H7N3O2/c1-8-3(6)2-4(9)7-5(8)10/h6H,2H2,1H3,(H,7,9,10)/b6-3+ |
| InChIKey | ZSOJYTAZHGKSKR-ZZXKWVIFSA-N |
| XLogP | -0.46 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|