C7H10BrN3O2 — CID 140537494
5-bromo-6-imino-3-propyl-1,3-diazinane-2,4-dione (PubChem CID 140537494) has the molecular formula C7H10BrN3O2 and a molecular weight of 248.08 g/mol. Its IUPAC name is 5-bromo-6-imino-3-propyl-1,3-diazinane-2,4-dione.
| Compound Name | 5-bromo-6-imino-3-propyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 140537494 |
| Molecular Formula | C7H10BrN3O2 |
| Molecular Weight | 248.08 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 5-bromo-6-imino-3-propyl-1,3-diazinane-2,4-dione |
| SMILES | [H]/N=C1\NC(=O)N(CCC)C(=O)C1Br |
| InChI | InChI=1S/C7H10BrN3O2/c1-2-3-11-6(12)4(8)5(9)10-7(11)13/h4H,2-3H2,1H3,(H2,9,10,13) |
| InChIKey | UCMPWVIWQIQGQW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.08 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|