C8H13N3O2 — CID 134870171
1-butyl-6-imino-1,3-diazinane-2,4-dione (PubChem CID 134870171) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 1-butyl-6-imino-1,3-diazinane-2,4-dione.
| Compound Name | 1-butyl-6-imino-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 134870171 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 1-butyl-6-imino-1,3-diazinane-2,4-dione |
| SMILES | [H]/N=C1\CC(=O)NC(=O)N1CCCC |
| InChI | InChI=1S/C8H13N3O2/c1-2-3-4-11-6(9)5-7(12)10-8(11)13/h9H,2-5H2,1H3,(H,10,12,13)/b9-6+ |
| InChIKey | FWAAEKBNSZQVTO-RMKNXTFCSA-N |
| XLogP | 0.71 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|