C6H11N4O2+ — CID 6933599
[amino-[(5R)-1-methyl-2,4-dioxo-1,3-diazinan-5-yl]methylidene]azanium (PubChem CID 6933599) has the molecular formula C6H11N4O2+ and a molecular weight of 171.18 g/mol. Its IUPAC name is [amino-[(5R)-1-methyl-2,4-dioxo-1,3-diazinan-5-yl]methylidene]azanium.
| Compound Name | [amino-[(5R)-1-methyl-2,4-dioxo-1,3-diazinan-5-yl]methylidene]azanium |
|---|---|
| PubChem CID | 6933599 |
| Molecular Formula | C6H11N4O2+ |
| Molecular Weight | 171.18 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | [amino-[(5R)-1-methyl-2,4-dioxo-1,3-diazinan-5-yl]methylidene]azanium |
| SMILES | CN1C[C@H](C(N)=[NH2+])C(=O)NC1=O |
| InChI | InChI=1S/C6H10N4O2/c1-10-2-3(4(7)8)5(11)9-6(10)12/h3H,2H2,1H3,(H3,7,8)(H,9,11,12)/p+1/t3-/m1/s1 |
| InChIKey | IXPNQXFRVYWDDI-GSVOUGTGSA-O |
| XLogP | -3.10 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.18 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|