C5H5N3O3 — CID 118951808
1-methanimidoyl-1,3-diazinane-2,4,6-trione (PubChem CID 118951808) has the molecular formula C5H5N3O3 and a molecular weight of 155.11 g/mol. Its IUPAC name is 1-methanimidoyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-methanimidoyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 118951808 |
| Molecular Formula | C5H5N3O3 |
| Molecular Weight | 155.11 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | 1-methanimidoyl-1,3-diazinane-2,4,6-trione |
| SMILES | [H]/N=C/N1C(=O)CC(=O)NC1=O |
| InChI | InChI=1S/C5H5N3O3/c6-2-8-4(10)1-3(9)7-5(8)11/h2,6H,1H2,(H,7,9,11)/b6-2+ |
| InChIKey | DVDNMGTYOLPQHF-QHHAFSJGSA-N |
| XLogP | -0.94 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.11 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|