C10H15NO3 — CID 131857680
ethyl (3aR,6aR)-3-oxo-1,2,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylate (PubChem CID 131857680) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is ethyl (3aR,6aR)-3-oxo-1,2,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylate.
| Compound Name | ethyl (3aR,6aR)-3-oxo-1,2,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 131857680 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | ethyl (3aR,6aR)-3-oxo-1,2,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCC[C@H]1CNC2=O |
| InChI | InChI=1S/C10H15NO3/c1-2-14-9(13)10-5-3-4-7(10)6-11-8(10)12/h7H,2-6H2,1H3,(H,11,12)/t7-,10+/m0/s1 |
| InChIKey | NOAMBHNXCFZDKC-OIBJUYFYSA-N |
| XLogP | 0.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|