C10H14Cl2O2 — CID 131857780
(6Z)-9,9-dichloro-2-methyl-3,4,5,8-tetrahydro-2H-oxecin-10-one (PubChem CID 131857780) has the molecular formula C10H14Cl2O2 and a molecular weight of 237.13 g/mol. Its IUPAC name is (6Z)-9,9-dichloro-2-methyl-3,4,5,8-tetrahydro-2H-oxecin-10-one.
| Compound Name | (6Z)-9,9-dichloro-2-methyl-3,4,5,8-tetrahydro-2H-oxecin-10-one |
|---|---|
| PubChem CID | 131857780 |
| Molecular Formula | C10H14Cl2O2 |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | (6Z)-9,9-dichloro-2-methyl-3,4,5,8-tetrahydro-2H-oxecin-10-one |
| SMILES | CC1CCC/C=C\CC(Cl)(Cl)C(=O)O1 |
| InChI | InChI=1S/C10H14Cl2O2/c1-8-6-4-2-3-5-7-10(11,12)9(13)14-8/h3,5,8H,2,4,6-7H2,1H3/b5-3- |
| InChIKey | SMAKCCNDQNANPD-HYXAFXHYSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|