C8H10F5NO3 — CID 131857821
ethyl N-ethoxycarbonyl-2,2,3,3,3-pentafluoropropanimidate (PubChem CID 131857821) has the molecular formula C8H10F5NO3 and a molecular weight of 263.16 g/mol. Its IUPAC name is ethyl N-ethoxycarbonyl-2,2,3,3,3-pentafluoropropanimidate.
| Compound Name | ethyl N-ethoxycarbonyl-2,2,3,3,3-pentafluoropropanimidate |
|---|---|
| PubChem CID | 131857821 |
| Molecular Formula | C8H10F5NO3 |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | ethyl N-ethoxycarbonyl-2,2,3,3,3-pentafluoropropanimidate |
| SMILES | CCOC(=O)N=C(OCC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F5NO3/c1-3-16-5(14-6(15)17-4-2)7(9,10)8(11,12)13/h3-4H2,1-2H3 |
| InChIKey | CRZLRQHCPHLQNQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|